C32H30N6O4S — CID 6118419
2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6118419) has the molecular formula C32H30N6O4S and a molecular weight of 594.70 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6118419 |
| Molecular Formula | C32H30N6O4S |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C\c3ccc(OCc4ccccc4)c(OC)c3)nnc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C32H30N6O4S/c1-3-41-27-14-12-26(13-15-27)38-31(25-10-7-17-33-20-25)36-37-32(38)43-22-30(39)35-34-19-24-11-16-28(29(18-24)40-2)42-21-23-8-5-4-6-9-23/h4-20H,3,21-22H2,1-2H3,(H,35,39)/b34-19- |
| InChIKey | GMEXIEQMABCCCM-FZKWRIDDSA-N |
| XLogP | 5.56 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|