C27H28N6O4S — CID 4500558
N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4500558) has the molecular formula C27H28N6O4S and a molecular weight of 532.63 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4500558 |
| Molecular Formula | C27H28N6O4S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=C(C)c3ccc(OC)c(OC)c3)nnc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C27H28N6O4S/c1-5-37-22-11-9-21(10-12-22)33-26(20-7-6-14-28-16-20)31-32-27(33)38-17-25(34)30-29-18(2)19-8-13-23(35-3)24(15-19)36-4/h6-16H,5,17H2,1-4H3,(H,30,34) |
| InChIKey | BCLAXZWYRWCUPH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|