C25H23N7O4S — CID 6118617
2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide (PubChem CID 6118617) has the molecular formula C25H23N7O4S and a molecular weight of 517.57 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6118617 |
| Molecular Formula | C25H23N7O4S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C(/C)c3ccc([N+](=O)[O-])cc3)nnc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C25H23N7O4S/c1-3-36-22-12-10-20(11-13-22)31-24(19-5-4-14-26-15-19)29-30-25(31)37-16-23(33)28-27-17(2)18-6-8-21(9-7-18)32(34)35/h4-15H,3,16H2,1-2H3,(H,28,33)/b27-17- |
| InChIKey | PXKHKOHKTHCHOH-PKAZHMFMSA-N |
| XLogP | 4.27 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|