C26H23ClN6O4S — CID 6238356
2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-1-(4-nitrophenyl)ethylideneamino]acetamide (PubChem CID 6238356) has the molecular formula C26H23ClN6O4S and a molecular weight of 551.03 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-1-(4-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-1-(4-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6238356 |
| Molecular Formula | C26H23ClN6O4S |
| Molecular Weight | 551.03 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-1-(4-nitrophenyl)ethylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C(\C)c3ccc([N+](=O)[O-])cc3)nnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN6O4S/c1-3-37-23-14-12-21(13-15-23)32-25(19-4-8-20(27)9-5-19)30-31-26(32)38-16-24(34)29-28-17(2)18-6-10-22(11-7-18)33(35)36/h4-15H,3,16H2,1-2H3,(H,29,34)/b28-17+ |
| InChIKey | GJCWARSKAWDLAA-OGLMXYFKSA-N |
| XLogP | 5.53 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.03 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|