C19H10Cl2N4O4S2 — CID 6040520
2,4-dichloro-N-[(Z)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide (PubChem CID 6040520) has the molecular formula C19H10Cl2N4O4S2 and a molecular weight of 493.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6040520 |
| Molecular Formula | C19H10Cl2N4O4S2 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(Sc2nc3ccc([N+](=O)[O-])cc3s2)o1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H10Cl2N4O4S2/c20-10-1-4-13(14(21)7-10)18(26)24-22-9-12-3-6-17(29-12)31-19-23-15-5-2-11(25(27)28)8-16(15)30-19/h1-9H,(H,24,26)/b22-9- |
| InChIKey | HDUWWWIDVQYOJO-AFPJDJCSSA-N |
| XLogP | 6.02 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|