C17H11Cl2N3O4 — CID 133064909
2,4-dichloro-N-[(E)-(5-methyl-7-nitro-1-benzofuran-2-yl)methylideneamino]benzamide (PubChem CID 133064909) has the molecular formula C17H11Cl2N3O4 and a molecular weight of 392.20 g/mol. Its IUPAC name is 2,4-dichloro-N-[(E)-(5-methyl-7-nitro-1-benzofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(E)-(5-methyl-7-nitro-1-benzofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133064909 |
| Molecular Formula | C17H11Cl2N3O4 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 2,4-dichloro-N-[(E)-(5-methyl-7-nitro-1-benzofuran-2-yl)methylideneamino]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])c2oc(/C=N/NC(=O)c3ccc(Cl)cc3Cl)cc2c1 |
| InChI | InChI=1S/C17H11Cl2N3O4/c1-9-4-10-6-12(26-16(10)15(5-9)22(24)25)8-20-21-17(23)13-3-2-11(18)7-14(13)19/h2-8H,1H3,(H,21,23)/b20-8+ |
| InChIKey | JERSTHRQQZFVQH-DNTJNYDQSA-N |
| XLogP | 4.72 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|