C22H20N4O3S2 — CID 3645451
N,N-diethyl-4-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]aniline (PubChem CID 3645451) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]aniline.
| Compound Name | N,N-diethyl-4-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 3645451 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N,N-diethyl-4-[[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]aniline |
| SMILES | CCN(CC)c1ccc(/N=C/c2ccc(Sc3nc4ccc([N+](=O)[O-])cc4s3)o2)cc1 |
| InChI | InChI=1S/C22H20N4O3S2/c1-3-25(4-2)16-7-5-15(6-8-16)23-14-18-10-12-21(29-18)31-22-24-19-11-9-17(26(27)28)13-20(19)30-22/h5-14H,3-4H2,1-2H3/b23-14+ |
| InChIKey | QUZTYXNJOJVSDP-OEAKJJBVSA-N |
| XLogP | 6.55 |
| TPSA | 84.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|