C23H26N2O3 — CID 50866768
5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-hydroxybenzoic acid (PubChem CID 50866768) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 50866768 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-hydroxybenzoic acid |
| SMILES | CCN1c2cc(C)c(/C=N/c3ccc(O)c(C(=O)O)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H26N2O3/c1-6-25-20-9-14(2)16(10-18(20)15(3)12-23(25,4)5)13-24-17-7-8-21(26)19(11-17)22(27)28/h7-13,26H,6H2,1-5H3,(H,27,28)/b24-13+ |
| InChIKey | WVGJTHSTDOZCQG-ZMOGYAJESA-N |
| XLogP | 5.17 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|