C26H34N2 — CID 50866388
N-(4-butan-2-ylphenyl)-1-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methanimine (PubChem CID 50866388) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-1-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methanimine.
| Compound Name | N-(4-butan-2-ylphenyl)-1-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50866388 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-1-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methanimine |
| SMILES | CCC(C)c1ccc(/N=C/c2cc3c(cc2C)N(CC)C(C)(C)C=C3C)cc1 |
| InChI | InChI=1S/C26H34N2/c1-8-18(3)21-10-12-23(13-11-21)27-17-22-15-24-20(5)16-26(6,7)28(9-2)25(24)14-19(22)4/h10-18H,8-9H2,1-7H3/b27-17+ |
| InChIKey | LWKCBKFXEDZDAW-WPWMEQJKSA-N |
| XLogP | 7.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|