C22H29N5OS — CID 50858266
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50858266) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50858266 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N/N=C\c2ccc3c(c2)C(C)CC(C)(C)N3C)n1 |
| InChI | InChI=1S/C22H29N5OS/c1-14-11-22(4,5)27(6)19-8-7-17(10-18(14)19)12-23-26-20(28)13-29-21-24-15(2)9-16(3)25-21/h7-10,12,14H,11,13H2,1-6H3,(H,26,28)/b23-12- |
| InChIKey | PCKAILIXLLFZRO-FMCGGJTJSA-N |
| XLogP | 4.06 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|