C22H26N4O3S — CID 133170304
2-(4-nitrophenyl)sulfanyl-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide (PubChem CID 133170304) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 133170304 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=N/NC(=O)CSc3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C22H26N4O3S/c1-15-12-22(2,3)25(4)20-10-5-16(11-19(15)20)13-23-24-21(27)14-30-18-8-6-17(7-9-18)26(28)29/h5-11,13,15H,12,14H2,1-4H3,(H,24,27)/b23-13+ |
| InChIKey | HIFOKQJWIVQSMW-YDZHTSKRSA-N |
| XLogP | 4.56 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|