C25H27BrN2O — CID 50870009
(Z)-2-(4-bromophenyl)-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enenitrile (PubChem CID 50870009) has the molecular formula C25H27BrN2O and a molecular weight of 451.41 g/mol. Its IUPAC name is (Z)-2-(4-bromophenyl)-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-bromophenyl)-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 50870009 |
| Molecular Formula | C25H27BrN2O |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (Z)-2-(4-bromophenyl)-3-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)prop-2-enenitrile |
| SMILES | CCCN1c2cc(OC)c(/C=C(\C#N)c3ccc(Br)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H27BrN2O/c1-6-11-28-23-14-24(29-5)19(13-22(23)17(2)15-25(28,3)4)12-20(16-27)18-7-9-21(26)10-8-18/h7-10,12-15H,6,11H2,1-5H3/b20-12+ |
| InChIKey | WUHBFAUWRAKXSS-UDWIEESQSA-N |
| XLogP | 6.93 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|