C19H20FN3 — CID 50869539
2-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]propanedinitrile (PubChem CID 50869539) has the molecular formula C19H20FN3 and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 50869539 |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]propanedinitrile |
| SMILES | CCCN1c2cc(F)c(C=C(C#N)C#N)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C19H20FN3/c1-5-6-23-18-9-17(20)15(7-14(11-21)12-22)8-16(18)13(2)10-19(23,3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | HTYFFLQBJZKXRJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|