C25H25F3N2O — CID 50867698
(Z)-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 50867698) has the molecular formula C25H25F3N2O and a molecular weight of 426.48 g/mol. Its IUPAC name is (Z)-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 50867698 |
| Molecular Formula | C25H25F3N2O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (Z)-3-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-2-[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | CCN1c2cc(OC)c(/C=C(\C#N)c3cccc(C(F)(F)F)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H25F3N2O/c1-6-30-22-13-23(31-5)18(12-21(22)16(2)14-24(30,3)4)10-19(15-29)17-8-7-9-20(11-17)25(26,27)28/h7-14H,6H2,1-5H3/b19-10+ |
| InChIKey | AKCSUUJIGYGGPS-VXLYETTFSA-N |
| XLogP | 6.80 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|