C20H27N3O — CID 132651100
(Z)-2-cyano-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-N-methylprop-2-enamide (PubChem CID 132651100) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-N-methylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 132651100 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (Z)-2-cyano-3-(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)-N-methylprop-2-enamide |
| SMILES | CCN1c2cc(C)c(/C=C(/C#N)C(=O)NC)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C20H27N3O/c1-7-23-18-8-13(2)15(9-16(12-21)19(24)22-6)10-17(18)14(3)11-20(23,4)5/h8-10,14H,7,11H2,1-6H3,(H,22,24)/b16-9- |
| InChIKey | QHHKDADEYWVMEL-SXGWCWSVSA-N |
| XLogP | 3.76 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|