C27H32FN3O — CID 50863658
(E)-2-cyano-N-(2-ethylphenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide (PubChem CID 50863658) has the molecular formula C27H32FN3O and a molecular weight of 433.57 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-ethylphenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-ethylphenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50863658 |
| Molecular Formula | C27H32FN3O |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (E)-2-cyano-N-(2-ethylphenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
| SMILES | CCCN1c2cc(F)c(/C=C(\C#N)C(=O)Nc3ccccc3CC)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C27H32FN3O/c1-6-12-31-25-15-23(28)20(14-22(25)18(3)16-27(31,4)5)13-21(17-29)26(32)30-24-11-9-8-10-19(24)7-2/h8-11,13-15,18H,6-7,12,16H2,1-5H3,(H,30,32)/b21-13+ |
| InChIKey | JEDVDNFLQMOUJD-FYJGNVAPSA-N |
| XLogP | 6.44 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|