C26H30ClN3O — CID 124649410
(Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]prop-2-enamide (PubChem CID 124649410) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is (Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]prop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 124649410 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | (Z)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[(4R)-1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl]prop-2-enamide |
| SMILES | CCN1c2cc(C)c(/C=C(/C#N)C(=O)Nc3cccc(Cl)c3C)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C26H30ClN3O/c1-7-30-24-11-16(2)19(13-21(24)17(3)14-26(30,5)6)12-20(15-28)25(31)29-23-10-8-9-22(27)18(23)4/h8-13,17H,7,14H2,1-6H3,(H,29,31)/b20-12-/t17-/m1/s1 |
| InChIKey | ODSSVYPWHTUBNQ-SYERDGIWSA-N |
| XLogP | 6.61 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|