C25H26Cl2FN3O — CID 50863635
(E)-2-cyano-N-(2,4-dichlorophenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide (PubChem CID 50863635) has the molecular formula C25H26Cl2FN3O and a molecular weight of 474.41 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dichlorophenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50863635 |
| Molecular Formula | C25H26Cl2FN3O |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-(7-fluoro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
| SMILES | CCCN1c2cc(F)c(/C=C(\C#N)C(=O)Nc3ccc(Cl)cc3Cl)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H26Cl2FN3O/c1-5-8-31-23-12-21(28)16(10-19(23)15(2)13-25(31,3)4)9-17(14-29)24(32)30-22-7-6-18(26)11-20(22)27/h6-7,9-12,15H,5,8,13H2,1-4H3,(H,30,32)/b17-9+ |
| InChIKey | ZRXIIIXJZJRRIK-RQZCQDPDSA-N |
| XLogP | 7.18 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|