C17H12FN3O3 — CID 20834786
(Z)-2-cyano-3-(4-fluorophenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide (PubChem CID 20834786) has the molecular formula C17H12FN3O3 and a molecular weight of 325.30 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-fluorophenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-fluorophenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 20834786 |
| Molecular Formula | C17H12FN3O3 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (Z)-2-cyano-3-(4-fluorophenyl)-N-(2-methyl-4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)/C(C#N)=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12FN3O3/c1-11-8-15(21(23)24)6-7-16(11)20-17(22)13(10-19)9-12-2-4-14(18)5-3-12/h2-9H,1H3,(H,20,22)/b13-9- |
| InChIKey | ZZFJUPPEPWQINK-LCYFTJDESA-N |
| XLogP | 3.59 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|