C18H12F3N3O3 — CID 3134887
2-cyano-N-(2-methyl-4-nitrophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 3134887) has the molecular formula C18H12F3N3O3 and a molecular weight of 375.31 g/mol. Its IUPAC name is 2-cyano-N-(2-methyl-4-nitrophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2-methyl-4-nitrophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3134887 |
| Molecular Formula | C18H12F3N3O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-cyano-N-(2-methyl-4-nitrophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3N3O3/c1-11-7-15(24(26)27)5-6-16(11)23-17(25)13(10-22)8-12-3-2-4-14(9-12)18(19,20)21/h2-9H,1H3,(H,23,25) |
| InChIKey | RYMOGBHLGPULNN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|