C18H12ClF3N2O — CID 7801437
(E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 7801437) has the molecular formula C18H12ClF3N2O and a molecular weight of 364.75 g/mol. Its IUPAC name is (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7801437 |
| Molecular Formula | C18H12ClF3N2O |
| Molecular Weight | 364.75 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12ClF3N2O/c1-11-15(19)6-3-7-16(11)24-17(25)13(10-23)8-12-4-2-5-14(9-12)18(20,21)22/h2-9H,1H3,(H,24,25)/b13-8+ |
| InChIKey | HLQSKCUQLOYKRJ-MDWZMJQESA-N |
| XLogP | 5.21 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|