C20H16IN3O6 — CID 3134513
[4-[2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 3134513) has the molecular formula C20H16IN3O6 and a molecular weight of 521.27 g/mol. Its IUPAC name is [4-[2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 3134513 |
| Molecular Formula | C20H16IN3O6 |
| Molecular Weight | 521.27 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | [4-[2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2C)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C20H16IN3O6/c1-11-6-15(24(27)28)4-5-17(11)23-20(26)14(10-22)7-13-8-16(21)19(30-12(2)25)18(9-13)29-3/h4-9H,1-3H3,(H,23,26) |
| InChIKey | CFWWOSZKKDQSQN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|