C20H15FIN3O6 — CID 1128251
[4-[(E)-2-cyano-3-(2-fluoro-5-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] acetate (PubChem CID 1128251) has the molecular formula C20H15FIN3O6 and a molecular weight of 539.26 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(2-fluoro-5-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] acetate.
| Compound Name | [4-[(E)-2-cyano-3-(2-fluoro-5-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] acetate |
|---|---|
| PubChem CID | 1128251 |
| Molecular Formula | C20H15FIN3O6 |
| Molecular Weight | 539.26 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | [4-[(E)-2-cyano-3-(2-fluoro-5-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] acetate |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2cc([N+](=O)[O-])ccc2F)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C20H15FIN3O6/c1-3-30-18-8-12(7-16(22)19(18)31-11(2)26)6-13(10-23)20(27)24-17-9-14(25(28)29)4-5-15(17)21/h4-9H,3H2,1-2H3,(H,24,27)/b13-6+ |
| InChIKey | QAVPSSKIXLNMGZ-AWNIVKPZSA-N |
| XLogP | 4.21 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|