C20H17IN4O6 — CID 126227617
(Z)-N-carbamoyl-2-cyano-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 126227617) has the molecular formula C20H17IN4O6 and a molecular weight of 536.28 g/mol. Its IUPAC name is (Z)-N-carbamoyl-2-cyano-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-carbamoyl-2-cyano-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126227617 |
| Molecular Formula | C20H17IN4O6 |
| Molecular Weight | 536.28 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | (Z)-N-carbamoyl-2-cyano-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC(N)=O)cc(I)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17IN4O6/c1-2-30-17-9-13(6-14(10-22)19(26)24-20(23)27)8-16(21)18(17)31-11-12-4-3-5-15(7-12)25(28)29/h3-9H,2,11H2,1H3,(H3,23,24,26,27)/b14-6- |
| InChIKey | PYYZZAILHHKGQI-NSIKDUERSA-N |
| XLogP | 3.28 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|