C20H17ClN4O — CID 47006188
(E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 47006188) has the molecular formula C20H17ClN4O and a molecular weight of 364.84 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 47006188 |
| Molecular Formula | C20H17ClN4O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | COc1cccc(Cn2nc(C)c(/C=C(/C#N)c3ccccn3)c2Cl)c1 |
| InChI | InChI=1S/C20H17ClN4O/c1-14-18(11-16(12-22)19-8-3-4-9-23-19)20(21)25(24-14)13-15-6-5-7-17(10-15)26-2/h3-11H,13H2,1-2H3/b16-11- |
| InChIKey | BWFHAKVWFQKZAE-WJDWOHSUSA-N |
| XLogP | 4.36 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|