C21H19Cl2N3O3 — CID 30752863
(6-chloro-3-pyridinyl)methyl (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 30752863) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 30752863 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl (E)-3-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | COc1cccc(Cn2nc(C)c(/C=C/C(=O)OCc3ccc(Cl)nc3)c2Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O3/c1-14-18(7-9-20(27)29-13-16-6-8-19(22)24-11-16)21(23)26(25-14)12-15-4-3-5-17(10-15)28-2/h3-11H,12-13H2,1-2H3/b9-7+ |
| InChIKey | CJEQIRIIMMHVFA-VQHVLOKHSA-N |
| XLogP | 4.71 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|