C23H20Cl2N4O3 — CID 3949229
ethyl 5-[3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 3949229) has the molecular formula C23H20Cl2N4O3 and a molecular weight of 471.34 g/mol. Its IUPAC name is ethyl 5-[3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3949229 |
| Molecular Formula | C23H20Cl2N4O3 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | ethyl 5-[3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)C(C#N)=Cc2c(C)nn(-c3cccc(Cl)c3)c2Cl)c1C |
| InChI | InChI=1S/C23H20Cl2N4O3/c1-5-32-23(31)19-12(2)20(27-14(19)4)21(30)15(11-26)9-18-13(3)28-29(22(18)25)17-8-6-7-16(24)10-17/h6-10,27H,5H2,1-4H3 |
| InChIKey | HQPZPYDPXUVMSP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|