C25H28Cl2N2O3 — CID 3507401
ethyl 4-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate (PubChem CID 3507401) has the molecular formula C25H28Cl2N2O3 and a molecular weight of 475.42 g/mol. Its IUPAC name is ethyl 4-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl 4-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3507401 |
| Molecular Formula | C25H28Cl2N2O3 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | ethyl 4-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-1-(2-methylpropyl)-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(CC(C)C)C(=O)C1=Cc1cc(C)n(-c2cccc(Cl)c2Cl)c1C |
| InChI | InChI=1S/C25H28Cl2N2O3/c1-7-32-25(31)22-17(6)28(13-14(2)3)24(30)19(22)12-18-11-15(4)29(16(18)5)21-10-8-9-20(26)23(21)27/h8-12,14H,7,13H2,1-6H3 |
| InChIKey | FVMKFEFFOPPXCX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|