C22H16Cl2N2O5S — CID 98155858
(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 98155858) has the molecular formula C22H16Cl2N2O5S and a molecular weight of 491.35 g/mol. Its IUPAC name is (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 98155858 |
| Molecular Formula | C22H16Cl2N2O5S |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N([C@@H]2CCS(=O)(=O)C2)C(=O)/C1=C/c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C22H16Cl2N2O5S/c1-12-16(9-15-3-5-20(31-15)17-8-13(23)2-4-19(17)24)21(27)26(22(28)18(12)10-25)14-6-7-32(29,30)11-14/h2-5,8-9,14H,6-7,11H2,1H3/b16-9+/t14-/m1/s1 |
| InChIKey | PJMBWZAEUNEGAX-BRYYZUPOSA-N |
| XLogP | 4.03 |
| TPSA | 108.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|