C27H19N3O7S — CID 45132736
(5E)-1-(1,1-dioxothiolan-3-yl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile (PubChem CID 45132736) has the molecular formula C27H19N3O7S and a molecular weight of 529.53 g/mol. Its IUPAC name is (5E)-1-(1,1-dioxothiolan-3-yl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile.
| Compound Name | (5E)-1-(1,1-dioxothiolan-3-yl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 45132736 |
| Molecular Formula | C27H19N3O7S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | (5E)-1-(1,1-dioxothiolan-3-yl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)/C(=C\c2ccc(-c3ccccc3[N+](=O)[O-])o2)C(=O)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C27H19N3O7S/c28-15-22-25(17-6-2-1-3-7-17)21(26(31)29(27(22)32)18-12-13-38(35,36)16-18)14-19-10-11-24(37-19)20-8-4-5-9-23(20)30(33)34/h1-11,14,18H,12-13,16H2/b21-14+ |
| InChIKey | INHBNBUORIFGFB-KGENOOAVSA-N |
| XLogP | 3.77 |
| TPSA | 151.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|