C22H17N3O7S — CID 3316269
1-(1,1-dioxothiolan-3-yl)-4-methyl-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 3316269) has the molecular formula C22H17N3O7S and a molecular weight of 467.46 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methyl-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-methyl-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3316269 |
| Molecular Formula | C22H17N3O7S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-methyl-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C2CCS(=O)(=O)C2)C(=O)C1=Cc1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C22H17N3O7S/c1-13-18(10-17-5-6-20(32-17)14-3-2-4-15(9-14)25(28)29)21(26)24(22(27)19(13)11-23)16-7-8-33(30,31)12-16/h2-6,9-10,16H,7-8,12H2,1H3 |
| InChIKey | RSIHMJUJMRCZFD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 151.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|