C28H21BrN2O6S — CID 19131534
(5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19131534) has the molecular formula C28H21BrN2O6S and a molecular weight of 593.46 g/mol. Its IUPAC name is (5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19131534 |
| Molecular Formula | C28H21BrN2O6S |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | (5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-4-(4-methoxyphenyl)-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(C2=C(C#N)C(=O)N(C3CCS(=O)(=O)C3)C(=O)/C2=C\c2ccc(-c3cccc(Br)c3)o2)cc1 |
| InChI | InChI=1S/C28H21BrN2O6S/c1-36-21-7-5-17(6-8-21)26-23(14-22-9-10-25(37-22)18-3-2-4-19(29)13-18)27(32)31(28(33)24(26)15-30)20-11-12-38(34,35)16-20/h2-10,13-14,20H,11-12,16H2,1H3/b23-14- |
| InChIKey | JPAPVPJOGSVGSW-UCQKPKSFSA-N |
| XLogP | 4.63 |
| TPSA | 117.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|