C27H18Cl2N2O5S — CID 98333272
(5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-2,6-dioxo-4-phenylpyridine-3-carbonitrile (PubChem CID 98333272) has the molecular formula C27H18Cl2N2O5S and a molecular weight of 553.42 g/mol. Its IUPAC name is (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-2,6-dioxo-4-phenylpyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 98333272 |
| Molecular Formula | C27H18Cl2N2O5S |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | (5E)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-[(3R)-1,1-dioxothiolan-3-yl]-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)/C(=C\c2ccc(-c3cccc(Cl)c3Cl)o2)C(=O)N([C@@H]2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C27H18Cl2N2O5S/c28-22-8-4-7-19(25(22)29)23-10-9-18(36-23)13-20-24(16-5-2-1-3-6-16)21(14-30)27(33)31(26(20)32)17-11-12-37(34,35)15-17/h1-10,13,17H,11-12,15H2/b20-13+/t17-/m1/s1 |
| InChIKey | IXSQKKGSLJSIBW-UOBPLZBXSA-N |
| XLogP | 5.17 |
| TPSA | 108.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|