C21H16Cl2N2O4 — CID 3677630
5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 3677630) has the molecular formula C21H16Cl2N2O4 and a molecular weight of 431.28 g/mol. Its IUPAC name is 5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3677630 |
| Molecular Formula | C21H16Cl2N2O4 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CC(C)O)C(=O)C1=Cc1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C21H16Cl2N2O4/c1-11(26)10-25-20(27)15(12(2)16(9-24)21(25)28)8-13-6-7-18(29-13)14-4-3-5-17(22)19(14)23/h3-8,11,26H,10H2,1-2H3 |
| InChIKey | YROGJBZNMBUCPM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|