C24H17ClN6O4 — CID 21230871
benzyl 2-chloro-5-[5-[(Z)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 21230871) has the molecular formula C24H17ClN6O4 and a molecular weight of 488.89 g/mol. Its IUPAC name is benzyl 2-chloro-5-[5-[(Z)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | benzyl 2-chloro-5-[5-[(Z)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 21230871 |
| Molecular Formula | C24H17ClN6O4 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | benzyl 2-chloro-5-[5-[(Z)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CC1=NN(c2nn[nH]n2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)c(C(=O)OCc3ccccc3)c2)o1 |
| InChI | InChI=1S/C24H17ClN6O4/c1-14-18(22(32)31(28-14)24-26-29-30-27-24)12-17-8-10-21(35-17)16-7-9-20(25)19(11-16)23(33)34-13-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,26,27,29,30)/b18-12- |
| InChIKey | BLFWRFNKVJBEFD-PDGQHHTCSA-N |
| XLogP | 4.28 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|