C17H12FN5OS2 — CID 46253159
(6Z)-6-[[1-(2-fluorophenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46253159) has the molecular formula C17H12FN5OS2 and a molecular weight of 385.45 g/mol. Its IUPAC name is (6Z)-6-[[1-(2-fluorophenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-(2-fluorophenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46253159 |
| Molecular Formula | C17H12FN5OS2 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (6Z)-6-[[1-(2-fluorophenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cccn2-c2ccccc2F)/C(=O)N=C2SN=C(SC)N2/1 |
| InChI | InChI=1S/C17H12FN5OS2/c1-25-17-21-26-16-20-15(24)11(14(19)23(16)17)9-10-5-4-8-22(10)13-7-3-2-6-12(13)18/h2-9,19H,1H3/b11-9-,19-14- |
| InChIKey | QDRSPSBEIIOEQR-FVDMYRIMSA-N |
| XLogP | 3.56 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|