C24H18FN5OS — CID 46253097
(6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-2-(4-fluorophenyl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46253097) has the molecular formula C24H18FN5OS and a molecular weight of 443.51 g/mol. Its IUPAC name is (6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-2-(4-fluorophenyl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-2-(4-fluorophenyl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46253097 |
| Molecular Formula | C24H18FN5OS |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-2-(4-fluorophenyl)-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2-c2c(C)cccc2C)/C(=O)N=C2SC(c3ccc(F)cc3)=NN2/1 |
| InChI | InChI=1S/C24H18FN5OS/c1-14-5-3-6-15(2)20(14)29-12-4-7-18(29)13-19-21(26)30-24(27-22(19)31)32-23(28-30)16-8-10-17(25)11-9-16/h3-13,26H,1-2H3/b19-13+,26-21- |
| InChIKey | GFZACOUPCAOJST-JNHDIHBKSA-N |
| XLogP | 4.90 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|