C26H23N5O2S — CID 46253114
(6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46253114) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is (6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46253114 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (6E)-6-[[1-(2,6-dimethylphenyl)pyrrol-2-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2-c2c(C)cccc2C)/C(=O)N=C2SC(COc3ccccc3C)=NN2/1 |
| InChI | InChI=1S/C26H23N5O2S/c1-16-8-4-5-12-21(16)33-15-22-29-31-24(27)20(25(32)28-26(31)34-22)14-19-11-7-13-30(19)23-17(2)9-6-10-18(23)3/h4-14,27H,15H2,1-3H3/b20-14+,27-24- |
| InChIKey | MSDABCVBEPAYKC-RQGKAJNZSA-N |
| XLogP | 5.10 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|