C18H14ClN5O3S2 — CID 12004618
(6Z)-6-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 12004618) has the molecular formula C18H14ClN5O3S2 and a molecular weight of 447.93 g/mol. Its IUPAC name is (6Z)-6-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 12004618 |
| Molecular Formula | C18H14ClN5O3S2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | (6Z)-6-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2-c2ccc(C)c(Cl)c2)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C18H14ClN5O3S2/c1-10-5-6-12(9-14(10)19)23-7-3-4-11(23)8-13-15(20)24-17(21-16(13)25)28-22-18(24)29(2,26)27/h3-9,20H,1-2H3/b13-8-,20-15+ |
| InChIKey | LDXIDWXNUJDJMV-YRAILMQZSA-N |
| XLogP | 3.06 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|