C23H21ClN4O6S2 — CID 46251707
(6Z)-6-[[3-chloro-5-methoxy-4-(3-phenoxypropoxy)phenyl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46251707) has the molecular formula C23H21ClN4O6S2 and a molecular weight of 549.03 g/mol. Its IUPAC name is (6Z)-6-[[3-chloro-5-methoxy-4-(3-phenoxypropoxy)phenyl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[3-chloro-5-methoxy-4-(3-phenoxypropoxy)phenyl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46251707 |
| Molecular Formula | C23H21ClN4O6S2 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | (6Z)-6-[[3-chloro-5-methoxy-4-(3-phenoxypropoxy)phenyl]methylidene]-5-imino-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cc(Cl)c(OCCCOc3ccccc3)c(OC)c2)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C23H21ClN4O6S2/c1-32-18-13-14(12-17(24)19(18)34-10-6-9-33-15-7-4-3-5-8-15)11-16-20(25)28-22(26-21(16)29)35-27-23(28)36(2,30)31/h3-5,7-8,11-13,25H,6,9-10H2,1-2H3/b16-11-,25-20+ |
| InChIKey | SWDOSNOLIBCTQN-WDXHBENASA-N |
| XLogP | 3.82 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|