C22H20N4O6S2 — CID 46251553
(6Z)-5-imino-6-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46251553) has the molecular formula C22H20N4O6S2 and a molecular weight of 500.56 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46251553 |
| Molecular Formula | C22H20N4O6S2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | (6Z)-5-imino-6-[[4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(OCCOc3ccccc3OC)cc2)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C22H20N4O6S2/c1-30-17-5-3-4-6-18(17)32-12-11-31-15-9-7-14(8-10-15)13-16-19(23)26-21(24-20(16)27)33-25-22(26)34(2,28)29/h3-10,13,23H,11-12H2,1-2H3/b16-13-,23-19+ |
| InChIKey | RCXIXVFLVJWOSB-WILHXAKISA-N |
| XLogP | 2.77 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|