C20H11ClN4O2S3 — CID 3834073
6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3834073) has the molecular formula C20H11ClN4O2S3 and a molecular weight of 470.99 g/mol. Its IUPAC name is 6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3834073 |
| Molecular Formula | C20H11ClN4O2S3 |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | 6-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-5-imino-2-thiophen-2-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(Sc3ccc(Cl)cc3)o2)C(=O)N=C2SC(c3cccs3)=NN21 |
| InChI | InChI=1S/C20H11ClN4O2S3/c21-11-3-6-13(7-4-11)29-16-8-5-12(27-16)10-14-17(22)25-20(23-18(14)26)30-19(24-25)15-2-1-9-28-15/h1-10,22H/b14-10?,22-17+ |
| InChIKey | ZCQIWZKBZSZRDX-IGIXWZLGSA-N |
| XLogP | 5.81 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|