C19H23N5OS2 — CID 46248140
(6Z)-6-[[4-(diethylamino)phenyl]methylidene]-5-imino-3-propan-2-ylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46248140) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is (6Z)-6-[[4-(diethylamino)phenyl]methylidene]-5-imino-3-propan-2-ylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[4-(diethylamino)phenyl]methylidene]-5-imino-3-propan-2-ylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46248140 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (6Z)-6-[[4-(diethylamino)phenyl]methylidene]-5-imino-3-propan-2-ylsulfanyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(N(CC)CC)cc2)/C(=O)N=C2SN=C(SC(C)C)N2/1 |
| InChI | InChI=1S/C19H23N5OS2/c1-5-23(6-2)14-9-7-13(8-10-14)11-15-16(20)24-18(21-17(15)25)27-22-19(24)26-12(3)4/h7-12,20H,5-6H2,1-4H3/b15-11-,20-16- |
| InChIKey | YZPYQOWTZAEPLC-NMTRILEFSA-N |
| XLogP | 4.25 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|