C17H13N3O2S — CID 4889847
3-(furan-2-ylmethylidene)-4-imino-7,8-dimethylpyrimido[2,1-b][1,3]benzothiazol-2-one (PubChem CID 4889847) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 3-(furan-2-ylmethylidene)-4-imino-7,8-dimethylpyrimido[2,1-b][1,3]benzothiazol-2-one.
| Compound Name | 3-(furan-2-ylmethylidene)-4-imino-7,8-dimethylpyrimido[2,1-b][1,3]benzothiazol-2-one |
|---|---|
| PubChem CID | 4889847 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-(furan-2-ylmethylidene)-4-imino-7,8-dimethylpyrimido[2,1-b][1,3]benzothiazol-2-one |
| SMILES | [H]/N=C1\C(=Cc2ccco2)C(=O)N=C2Sc3cc(C)c(C)cc3N21 |
| InChI | InChI=1S/C17H13N3O2S/c1-9-6-13-14(7-10(9)2)23-17-19-16(21)12(15(18)20(13)17)8-11-4-3-5-22-11/h3-8,18H,1-2H3/b12-8?,18-15+ |
| InChIKey | KKDONJIENXVBLJ-ZHIRMJCCSA-N |
| XLogP | 3.77 |
| TPSA | 69.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|