C24H19FN4O3S2 — CID 4887129
3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-imino-8-methylsulfonylpyrimido[2,1-b][1,3]benzothiazol-2-one (PubChem CID 4887129) has the molecular formula C24H19FN4O3S2 and a molecular weight of 494.57 g/mol. Its IUPAC name is 3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-imino-8-methylsulfonylpyrimido[2,1-b][1,3]benzothiazol-2-one.
| Compound Name | 3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-imino-8-methylsulfonylpyrimido[2,1-b][1,3]benzothiazol-2-one |
|---|---|
| PubChem CID | 4887129 |
| Molecular Formula | C24H19FN4O3S2 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-imino-8-methylsulfonylpyrimido[2,1-b][1,3]benzothiazol-2-one |
| SMILES | [H]/N=C1\C(=Cc2cc(C)n(-c3ccc(F)cc3)c2C)C(=O)N=C2Sc3cc(S(C)(=O)=O)ccc3N21 |
| InChI | InChI=1S/C24H19FN4O3S2/c1-13-10-15(14(2)28(13)17-6-4-16(25)5-7-17)11-19-22(26)29-20-9-8-18(34(3,31)32)12-21(20)33-24(29)27-23(19)30/h4-12,26H,1-3H3/b19-11?,26-22+ |
| InChIKey | UIRFSJXPWPRAGA-WHEUWRARSA-N |
| XLogP | 4.51 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|