C19H16N4O4S2 — CID 4886005
6-[(6-hydroxy-4-oxochromen-3-yl)methylidene]-5-imino-3-(2-methylpropylsulfanyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 4886005) has the molecular formula C19H16N4O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 6-[(6-hydroxy-4-oxochromen-3-yl)methylidene]-5-imino-3-(2-methylpropylsulfanyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | 6-[(6-hydroxy-4-oxochromen-3-yl)methylidene]-5-imino-3-(2-methylpropylsulfanyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4886005 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 6-[(6-hydroxy-4-oxochromen-3-yl)methylidene]-5-imino-3-(2-methylpropylsulfanyl)-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2coc3ccc(O)cc3c2=O)C(=O)N=C2SN=C(SCC(C)C)N21 |
| InChI | InChI=1S/C19H16N4O4S2/c1-9(2)8-28-19-22-29-18-21-17(26)13(16(20)23(18)19)5-10-7-27-14-4-3-11(24)6-12(14)15(10)25/h3-7,9,20,24H,8H2,1-2H3/b13-5?,20-16+ |
| InChIKey | WZSWKWJVYWTXKM-KEGVNSCOSA-N |
| XLogP | 3.46 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|