C26H24ClN5O4S — CID 5100190
6-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-imino-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 5100190) has the molecular formula C26H24ClN5O4S and a molecular weight of 538.03 g/mol. Its IUPAC name is 6-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-imino-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-imino-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 5100190 |
| Molecular Formula | C26H24ClN5O4S |
| Molecular Weight | 538.03 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 6-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-5-imino-2-(2-oxo-2-pyrrolidin-1-ylethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCc3ccc(Cl)cc3)c(OC)c2)C(=O)N=C2SC(CC(=O)N3CCCC3)=NN21 |
| InChI | InChI=1S/C26H24ClN5O4S/c1-35-21-13-17(6-9-20(21)36-15-16-4-7-18(27)8-5-16)12-19-24(28)32-26(29-25(19)34)37-22(30-32)14-23(33)31-10-2-3-11-31/h4-9,12-13,28H,2-3,10-11,14-15H2,1H3/b19-12?,28-24+ |
| InChIKey | BQSHIXZBXSNUAP-APSZRJAPSA-N |
| XLogP | 4.56 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.03 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|