C23H19N5O6S — CID 6072837
[4-[(Z)-[5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 6072837) has the molecular formula C23H19N5O6S and a molecular weight of 493.50 g/mol. Its IUPAC name is [4-[(Z)-[5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-[5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 6072837 |
| Molecular Formula | C23H19N5O6S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | [4-[(Z)-[5-imino-2-(2-morpholin-4-yl-2-oxoethyl)-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3ccco3)cc2)/C(=O)N=C2SC(CC(=O)N3CCOCC3)=NN2/1 |
| InChI | InChI=1S/C23H19N5O6S/c24-20-16(12-14-3-5-15(6-4-14)34-22(31)17-2-1-9-33-17)21(30)25-23-28(20)26-18(35-23)13-19(29)27-7-10-32-11-8-27/h1-6,9,12,24H,7-8,10-11,13H2/b16-12-,24-20- |
| InChIKey | XKPYQBVIZLHELZ-KQMZKAFUSA-N |
| XLogP | 2.37 |
| TPSA | 137.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|