C20H16N4O6S2 — CID 24789771
[4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 24789771) has the molecular formula C20H16N4O6S2 and a molecular weight of 472.50 g/mol. Its IUPAC name is [4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 24789771 |
| Molecular Formula | C20H16N4O6S2 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | [4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | [H]/N=C1C(=C\c2ccc(OC(=O)c3ccco3)cc2)\C(=O)N=C2SN=C(S(=O)(=O)C(C)C)N2\1 |
| InChI | InChI=1S/C20H16N4O6S2/c1-11(2)32(27,28)20-23-31-19-22-17(25)14(16(21)24(19)20)10-12-5-7-13(8-6-12)30-18(26)15-4-3-9-29-15/h3-11,21H,1-2H3/b14-10-,21-16+ |
| InChIKey | QICDQQYTFRMROR-POVPUTRVSA-N |
| XLogP | 2.90 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|