C16H15ClN4O6S3 — CID 46252292
[2-chloro-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 46252292) has the molecular formula C16H15ClN4O6S3 and a molecular weight of 490.97 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [2-chloro-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 46252292 |
| Molecular Formula | C16H15ClN4O6S3 |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | [2-chloro-4-[(Z)-(5-imino-7-oxo-3-propan-2-ylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-6-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | [H]/N=C1C(=C\c2ccc(OS(C)(=O)=O)c(Cl)c2)\C(=O)N=C2SN=C(S(=O)(=O)C(C)C)N2\1 |
| InChI | InChI=1S/C16H15ClN4O6S3/c1-8(2)30(25,26)16-20-28-15-19-14(22)10(13(18)21(15)16)6-9-4-5-12(11(17)7-9)27-29(3,23)24/h4-8,18H,1-3H3/b10-6-,18-13+ |
| InChIKey | UQZWBKOBCDYBPS-MXMWUFDHSA-N |
| XLogP | 2.08 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|